ChemNet > CAS > 4506-71-2 Ethyl 2-amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate
4506-71-2 Ethyl 2-amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate
نام محصول |
Ethyl 2-amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate |
نام انگلیسی |
Ethyl 2-amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate; 2-Amino-3-carbethoxy-4,5-tetramethylenethiophene; Ethyl-2-amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylat |
میدان مغناطیسی |
C11H15NO2S |
وزن مولکولی |
225.30 |
InChI |
InChI=1/C11H15NO2S/c1-2-14-11(13)9-7-5-3-4-6-8(7)15-10(9)12/h2-6,12H2,1H3 |
شماره سیایاس |
4506-71-2 |
تعداد کمیسیون اروپایی |
224-823-1 |
ساختار مولکولی |
|
نقطه ذوب |
114-117℃ |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|